Catalogue Number: CLK-056S-JEN
| Manufacturer: | Jena Bioscience |
| Shelf Life: | 12 months |
| Molecular Weight: | 1070.82 g/mol (free acid) |
| Molecular Formula: | C42H53N6O21P3 (free acid) |
| Ph: | 7.5 +/-0 |
| Physical state: | Solution |
| Type: | Conjugation Reagent |
| Shipping Condition: | Blue Ice |
| Unit(s): | 20 ul |
10-11 mM
5-Dibenzylcyclooctyl-PEG4-cytidine-5'-triphosphate, Triethylammonium salt
C(#CCNC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2c(C#Cc3c1cccc3)cccc2)c1cn(c(=O)nc1N)[C@H]1[C@@H]([C@@H]([C@H](O1)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
store at -20 °C|12 months after date of delivery|avoid freeze/thaw cycles|Short term exposure (up to 1 week cumulative) to ambient temperature possible.