Catalogue Number: CLK-062-JEN
| Manufacturer: | Jena Bioscience |
| Shelf Life: | 12 months |
| Molecular Formula: | C58H75N12O19P (free acid) |
| Physical state: | solid |
| Type: | Conjugation Reagent |
| Shipping Condition: | Blue Ice |
| Storage Condition: | RT |
| Unit(s): | 1 umol |
DMSO, very slightly soluble in water and MeOH
Triethylammonium salt
C(=O)(CCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2c(C#Cc3c1cccc3)cccc2)NCCCCCCNC(=O)/C=C/c1cn(c(=O)nc1N)[C@H]1C[C@@H]([C@H](O1)CO)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2c3c(nc2)c(=O)[nH]c(n3)N)O1)O)O
store at -20 °C|12 months after date of delivery||Short term exposure (up to 1 week cumulative) to ambient temperature possible.