Catalogue Number: CSB-MP004938HU(F1)J1-B-CSB
| Manufacturer: | Cusabio Biotech |
| Shelf Life: | 6 months |
| Molecular Weight: | 51 kDa |
| Physical state: | Lyophilized |
| Type: | Bioactive Proteins |
| Host Cell: | Mammalian Cells |
| Shipping Condition: | Blue Ice |
| Unit(s): | 100 ug, 20 ug, 1 mg |
| Host name: | |
| Clone: | |
| Isotype: | |
| Immunogen: |
CD44
960
P16070
mFc-AviTag™
The shelf life is related to many factors, storage state, buffer ingredients, storage temperature and the stability of the protein itself. Generally, the shelf life of liquid form is 6 months at -20°C/-80°C. The shelf life of lyophilized form is 12 months at -20°C/-80°C.