Catalogue Number: E0037-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C50H73N15O11 |
| Type: | Biochemicals |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg |
Bradykinin is a potent vasodilator peptide that exerts its vasodilatory action through stimulation of specific endothelial B2 receptors, thereby causing the release of prostacyclin, NO, and EDHF.
NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)N2CCCC2C(=O)NCC(=O)NC(CC3=CC=CC=C3)C(=O)NC(CO)C(=O)N4CCCC4C(=O)NC(CC5=CC=CC=C5)C(=O)NC(CCCN=C(N)N)C(O)=O
3 years -20°C powder