Catalogue Number: E0130-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C21H18O11 |
| Type: | Biochemicals |
| Alias: | Apigenin-7-glucuronide |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg |
Apigenin-7-O-glucuronide (Apigenin-7-glucuronide) is the major flavonoid found in milk thistle. Apigenin 7-o-glucuronide inhibits tumor necrosis factor alpha (TNF-α) and total nitrite release in lipopolysaccharide-activated macrophages.
OC1C(O)C(OC(C1O)C(O)=O)OC2=CC(=C3C(=O)C=C(OC3=C2)C4=CC=C(O)C=C4)O
3 years -20°C powder