Catalogue Number: E0143-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C14H10N2O3S |
| Type: | Biochemicals |
| Alias: | 2-(1'H-indole-3'-carbonyl)-thiazole-4-carboxylic acid methyl ester |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg, 5 mg |
ITE (2-(1'H-indole-3'-carbonyl)-thiazole-4-carboxylic acid methyl ester) is a potent endogenous agonist of aryl hydrocarbon receptor (AhR) that directly binds to AHR with a Ki of 3 nM.
COC(=O)C1=CSC(=N1)C(=O)C2=C[NH]C3=CC=CC=C23
3 years -20°C powder