Catalogue Number: LI-013-JEN
| Manufacturer: | Jena Bioscience |
| Shelf Life: | 12 months |
| Molecular Weight: | 560.43 g/mol |
| Molecular Formula: | C21H30N4O10P2 |
| Physical state: | Liquid |
| Type: | Chemicals |
| Shipping Condition: | Blue Ice |
| Unit(s): | 20 ul |
Description: NBD-FPP is a fluorescent analog of farnesyl pyrophosphate (FPP). It serves as lipid donor for geranylgeranyltransferases (RabGGTase, GGTase-I). NBD-FPP changes its fluorescence upon binding to protein substrates and allows for efficient fluorescence based GGTase activity assays and inhibitor screening.
1 mM
c1(ccc(c2c1non2)[N+](=O)[O-])NC/C(=C/CC/C(=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)/C)/C
store at -20 °C|12 months|avoid freeze/thaw cycles, store dark