Catalogue Number: NU-281-JEN
| Manufacturer: | Jena Bioscience |
| Shelf Life: | 12 months |
| Molecular Weight: | 273.19 g/mol (free acid) |
| Molecular Formula: | C8H12N5O4P (free acid) |
| Physical state: | solid |
| Type: | Enzyme Inhibitors |
| Alias: | PMEA |
| Shipping Condition: | RT |
| Storage Condition: | RT |
| Unit(s): | 100 mg |
n1cnc2c(ncn2CCOCP(=O)(O)O)c1N
P-[[2-(6-Amino-9H-purin-9-yl)ethoxy]methyl]phosphonic acid 9-(2-phosphonylmethoxyethyl)adenine
store at -20 °C|12 months after date of delivery||Short term exposure (up to 1 week cumulative) to ambient temperature possible.