Catalogue Number: NU-407-50-JEN
| Manufacturer: | Jena Bioscience |
| Shelf Life: | 6 months |
| Physical state: | solid |
| Type: | Nucleotides |
| Alias: | AMPPNHP |
| Shipping Condition: | Dry Ice |
| Unit(s): | 50 mg |
X-ray analysis[1, 2] Hydrolyse studies[3, 4]Agonistic ligand, mainly for nucleoside receptor A1 Nucleosidephosphates stabilized against hydrolytic degradation can directly bind to nucleoside receptors.
Adenosine-5'-[(β,γ)-imido]triphosphate, Tetralithium salt
Nc1c2c(n([C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)NP(=O)(O)O)O)O)cn2)ncn1
506.19 g/mol (free acid)
C10H17N6O12P3 (free acid)
72957-42-7
store at -20 °C|6 months after date of delivery