Catalogue Number: S0566-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C16H18N2O9S.Na |
| Type: | Cross-linkers |
| Shipping Condition: | Blue Ice |
| Unit(s): | 10 mg, 50 mg |
Sulfo-SMCC sodium is a hetero-bifunctional, noncleavable ADC crosslinker which consists of N-hydroxysuccinimide (NHS) ester and maleimide groups to react with primary amines and sulfhydryl groups.
C1CC(CCC1CN2C(=O)C=CC2=O)C(=O)ON3C(=O)CC(C3=O)S(=O)(=O)[O-].[Na+]
3 years -20°C powder