Catalogue Number: S0572-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C16H18N2O6 |
| Type: | Cross-linkers |
| Alias: | Succinimidyl-4-(N-maleimidomethyl cyclohexane)-1-carboxylate |
| Shipping Condition: | Blue Ice |
| Unit(s): | 100 mg |
SMCC (Succinimidyl-4-(N-maleimidomethyl cyclohexane)-1-carboxylate) is a hetero-bifunctional crosslinker that contain N-hydroxysuccinimide (NHS) ester and maleimide groups that allow covalent conjugation of amine- and sulfhydryl-containing molecules. SMCC-conjugated antigen couples spleen cells to induce antigen-specific immune responses.
C1CC(CCC1CN2C(=O)C=CC2=O)C(=O)ON3C(=O)CCC3=O
3 years -20°C powder