Catalogue Number: S0675-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C17H27N3O7S |
| Type: | Cross-linkers |
| Alias: | Azido-PEG5-OTs |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg |
Azide-PEG5-Tos (Azido-PEG5-OTs) is a cleavable 5-unit PEG ADC linker applied into the synthesis of antibody-drug conjugates (ADCs).
CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCN=[N+]=[N-]
2 years -20°C liquid