Catalogue Number: S1727-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C21H28O2 |
| Type: | Biochemicals |
| Alias: | D-Norgestrel |
| Shipping Condition: | Blue Ice |
| Unit(s): | 50 mg, 10 mM/ 1 mL, 1 g |
FOR RESEARCH USE ONLY
CCC12CCC3C(C1CCC2(C#C)O)CCC4=CC(=O)CCC34
Levonorgestrel (D-Norgestrel) is a female hormone that prevents ovulation.
2 years -80 in solvent