Catalogue Number: S2272-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C17H15NO3 |
| Type: | Other Inhibitors |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg |
Indoprofen is a nonsteroidal anti-inflammatory drug (NSAID) and cyclooxygenase (COX) inhibitor. Indoprofen prevents muscle wasting in aged mice through activation of PDK1/AKT pathway.Indoprofen selectively increases SMN2-luciferase reporter protein and endogenous SMN protein.
CC(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O
3 years -20°C powder