Catalogue Number: S2286-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C62H111N11O12 |
| Type: | Other Inhibitors |
| Alias: | Cyclosporine A, Cyclosporine, Ciclosporin, CsA,NSC 290193 |
| Shipping Condition: | Blue Ice |
| Unit(s): | 50 mg, 10 mM/ 1 mL, 200 mg, 1 g |
FOR RESEARCH USE ONLY
CCC1C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C
Cyclosporin A, a non-polar cyclic oligopeptide, is an immunosuppressive agent that binds to cyclophilin and then inhibits calcineurin with IC50 of 7 nM in a cell-free assay. Cyclosporin A is generally given following transplant surgery to prevent rejection and has been used to test its toxic effect on a perfused 3D proximal tubule model.Cyclosporin A (NSC 290193) can be used to induce animal models of Chronic Rejection of Liver Transplantation.
2 years -80 in solvent