Catalogue Number: S3724-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C49H54N8O8 |
| Type: | Protease Inhibitors |
| Alias: | GS-5816,VEL |
| Shipping Condition: | Blue Ice |
| Unit(s): | 100 mg, 25 mg |
CC1CCC(N1C(=O)C(C(C)C)NC(=O)OC)C2=NC3=C(N2)C=CC4=CC5=C(C=C43)OCC6=C5C=CC(=C6)C7=CN=C(N7)C8CC(CN8C(=O)C(C9=CC=CC=C9)NC(=O)OC)COC
Velpatasvir (GS-5816,VEL) is a second-generation NS5A inhibitor that inhibits hepatitis C viral replication through acting on the crucial "membranous web" that facilitates RNA replication.
2 years -80 in solvent