Catalogue Number: S3876-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C16H10N2O2 |
| Type: | Biochemicals |
| Alias: | Indigotin |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg |
Indigo (Indigotin) dye is an organic compound with a distinctive blue color. It is extracted from the leaves of certain plants or synthetic.
C1=CC=C2C(=C1)C(=C(N2)C3=NC4=CC=CC=C4C3=O)O
2 years -80 in solvent