Catalogue Number: S4630-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C8H7ClN2O2S |
| Type: | Biochemicals |
| Alias: | Sch-6783, SRG-95213 |
| Shipping Condition: | Blue Ice |
| Unit(s): | 100 mg, 500 mg |
CC1=NS(=O)(=O)C2=C(N1)C=CC(=C2)Cl
Diazoxide is a well-known small molecule that activates KATP channels in the smooth muscle of blood vessels and pancreatic beta-cells by increasing membrane permeability to potassium ions.
2 years -80 in solvent