Catalogue Number: S4737-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 24 months |
| Molecular Formula: | C11H6O3 |
| Type: | Biochemicals |
| Alias: | Psoralene, Ficusin, Furocoumarin |
| Shipping Condition: | Blue Ice |
| Unit(s): | 10 mg, 50 mg |
C1=CC(=O)OC2=CC3=C(C=CO3)C=C21
Psoralen (Psoralene, Ficusin, Furocoumarin) is a naturally occurring furocoumarin that intercalates with DNA, inhibiting DNA synthesis and cell division.
2 years -80 in solvent