Catalogue Number: S5564-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C12H16N2S |
| Type: | Biochemicals |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg |
Xylazine is a partial alpha-2 adrenergic agonist that is used for sedation, anesthesia, muscle relaxation, and analgesia in animals such as horses, cattle and other non-human mammals.
CC1=C(C(=CC=C1)C)NC2=NCCCS2
3 years -20°C powder