Catalogue Number: S5684-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C15H14O3 |
| Type: | Antibiotics and Antimycotics |
| Alias: | Tecomin, CI75490, Bethabarra wood, Greenhartin |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg, 5 mg |
84-79-7
C15H14O3
Lapachol (Tecomin, CI75490, Bethabarra wood, Greenhartin), a natural compound isolated from the bark of the lapacho tree, shows both antimicrobial and antiviral activity.
CC(=CCC1=C(C2=CC=CC=C2C(=O)C1=O)O)C
3 years -20°C powder