Catalogue Number: S5729-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C7H7O6P |
| Type: | Biochemicals |
| Alias: | 2-phosphonoxy benzoic acid |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg |
Fosfosal (2-phosphonoxy benzoic acid) is a non-acetylated salicylic acid derivative, with analgesic and anti-inflammatory activity, but without effects on PG biosynthesis in vitro.
C1=CC=C(C(=C1)C(=O)O)OP(=O)(O)O
3 years -20°C powder