Catalogue Number: S6824-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C28H22N4O6 |
| Type: | Probes |
| Alias: | NSC-151912, L-6868 |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg |
Lucigenin (NSC-151912, L-6868) is a fluoerscent probe that exhibits a bluish-green fluorescence in the presence of endogenously generated superoxide anion radicals and chloride in cells.
C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=C5C=CC=CC5=[N+](C6=CC=CC=C64)C.[N+](=O)([O-])[O-].[N+](=O)([O-])[O-]
3 years -20°C(in the dark) powder