Catalogue Number: S6924-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C11H7N2NaO3S2 |
| Type: | Biochemicals |
| Alias: | D-(-)-Luciferin sodium salt, Firefly luciferin sodium salt |
| Shipping Condition: | Blue Ice |
| Unit(s): | 100 mg, 25 mg |
D-Luciferin (D-(-)-Luciferin, Firefly luciferin) sodium salt is the natural substrate of luciferases that catalyze the production of light in bioluminescent insects.
OC1=CC=C2N=C(SC2=C1)C3=NC(CS3)C(=O)O[Na]
3 years -20°C(in the dark) powder