Catalogue Number: S8888-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C43H46F3N7O7S |
| Type: | Biochemicals |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg, 25 mg, 10 mM/1 ml |
GMB-475 is a proteolysis-targeting chimera (PROTAC) that allosterically targets BCR-ABL1 protein and recruit the E3 ligase Von Hippel-Lindau (VHL), resulting in ubiquitination and subsequent degradation of the oncogenic fusion protein.
CC1=C(SC=N1)C2=CC=C(CNC(=O)C3CC(O)CN3C(=O)C(NC(=O)COCCOC4=CC=C(C=C4)C5=CC(=NC=N5)NC6=CC=C(OC(F)(F)F)C=C6)C(C)(C)C)C=C2
3 years -20°C powder