Catalogue Number: S8914-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C12H14N4O8 |
| Type: | Biochemicals |
| Shipping Condition: | Blue Ice |
| Unit(s): | 25 mg, 5 mg, 10 mM/1 ml, 100 mg |
2-NBDG, a fluorescent deoxyglucose derivative, is a a marker for detecting glucose uptake and an indicaotr of cell viability.
C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NC(C=O)C(C(C(CO)O)O)O
3 years -20°C powder