Catalogue Number: S9057-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C10H16KNO9S2 |
| Type: | Antibiotics and Antimycotics |
| Alias: | Allylglucosinolate, 2-Propenylglucosinolate |
| Shipping Condition: | Blue Ice |
| Unit(s): | 1 mg |
3952-98-5
Sinigrin (Allylglucosinolate, 2-Propenylglucosinolate) is a glucosinolate found in some plants of the Brassicaceae family and exerts various activities including anticancer, anti-inflammatory, antibacterial, antifungal, antioxidant, and wound healing effects.
C=CCC(=NOS(=O)(=O)[O-])SC1C(C(C(C(O1)CO)O)O)O.[K+]
3 years -20°C powder
C10H16KNO9S2