Catalogue Number: S9076-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C34H42O20 |
| Type: | Other Inhibitors |
| Shipping Condition: | Blue Ice |
| Unit(s): | 1 mg, 5 mg |
Typhaneoside is a flavonoid glycoside plant extract that has an inhibitory effect on the proliferation of human umbilical arterial smooth muscle cell(HUASMC).
COC1=CC(=CC=C1O)C2=C(OC3OC(COC4OC(C)C(O)C(O)C4O)C(O)C(O)C3OC5OC(C)C(O)C(O)C5O)C(=O)C6=C(O2)C=C(O)C=C6O
3 years -20°C powder