Catalogue Number: S9099-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C21H20O11 |
| Type: | Biochemicals |
| Alias: | Lutexin, Luteolin-8-glucoside |
| Shipping Condition: | Blue Ice |
| Unit(s): | 1 mg, 5 mg |
Orientin (Lutexin, Luteolin-8-glucoside), isolated from medicinal plants, has various activities including anti-oxidant, anti-aging, anti-viral, anti-bacterial, anti-inflammation, vasodilatation and cardioprotective, antiadipogenesis, antinociceptive, radiation protective, neuroprotective, and antidepressant-like effects.
C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)O)O)O
3 years -20°C powder