Catalogue Number: S9115-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C22H20O11 |
| Type: | Biochemicals |
| Alias: | Oroxindin, Wogonin 7-O-glucuronide, Glychionide B |
| Shipping Condition: | Blue Ice |
| Unit(s): | 1 mg |
Wogonoside (Oroxindin, Wogonin 7-O-glucuronide, Glychionide B), the main flavonoid component derived from the root of Scutellaria baicalensis Georgi, displays anti-inflammatory, anti-angiogenic, and anticancer chemotherapeutic activities.
COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)OC4C(C(C(C(O4)C(=O)O)O)O)O
3 years -20°C powder