Catalogue Number: S9567-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C36H49N5O8S |
| Type: | Protease Inhibitors |
| Alias: | Crixivan, L-735524, MK-639 |
| Shipping Condition: | Blue Ice |
| Unit(s): | 1 mg, 5 mg |
CC(C)(C)NC(=O)C1CN(CCN1CC(CC(CC2=CC=CC=C2)C(=O)NC3C(CC4=CC=CC=C34)O)O)CC5=CN=CC=C5.OS(=O)(=O)O
Indinavir sulfate (Crixivan, L-735524, MK-639) is a specific and potent inhibitor of HIV-1 protease and is widely used in the treatment of AIDS.
3 years -20°C powder