Catalogue Number: S9935-SEL
| Manufacturer: | Selleck Chemicals |
| Shelf Life: | 36 months |
| Molecular Formula: | C164H252N44O55S |
| Type: | Peptide |
| Alias: | ALX-0600, Gattex, Revestive, TAK 633 |
| Shipping Condition: | Blue Ice |
| Unit(s): | 5 mg, 25 mg, 100 mg |
197922-42-2
Teduglutide (ALX-0600, Gattex, Revestive, TAK 633) is an analogue of human glucagon-like peptide-2 (GLP-2) and binds to the GLP-2 receptors. Teduglutide prolongs the intestinotrophic properties of GLP-2 in animal models.
CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CC(O)=O)NC(=O)C(CCCNC(N)=N)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC(N)=O)NC(=O)C(CC(O)=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(NC(=O)C(CC(N)=O)NC(=O)C(CCSC)NC(=O)C(CCC(O)=O)NC(=O)C(CC(O)=O)NC(=O)C(CO)NC(=O)C(CC4=CC=CC=C4)NC(=O)C(CO)NC(=O)CNC(=O)C(CC(O)=O)NC(=O)CNC(=O)C(N)CC5=CN=C[NH]5)C(C)O)C(C)CC)C(C)CC)C(=O)NC(CCC(N)=O)C(=O)NC(C(C)O)C(=O)NC(CCCCN)C(=O)NC(C(C)CC)C(=O)NC(C(C)O)C(=O)NC(CC(O)=O)C(O)=O
3 years -20°C powder